What is the 4-Butylresorcinol?

4-Butylresorcinol is Yellow or kind of white powder, while it's Molecular Formula is C10H14O2. Yellow or kind of white powder 4-Butylresorcinol is considered a potential Cytochrome P450 inhibitor. It can cause hypopigmentation due to its direct inhibition of tyrosinase.

What is the CAS number for 4-Butylresorcinol?

The CAS number of 4-Butylresorcinol is 18979-61-8.

What is 4-Butylresorcinol (18979-61-8) used for?

4-n-butylresorcinol is a derivative of resorcinol and a potent human tyrosinase inhibitor. It may be used to decrease skin irritation and is also known to inhibit melanin production.InChI:InChI=1/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3

What is the 4-Butylresorcinol?

4-Butylresorcinol is Yellow or kind of white powder, while it's Molecular Formula is C10H14O2. Yellow or kind of white powder 4-Butylresorcinol is considered a potential Cytochrome P450 inhibitor. It can cause hypopigmentation due to its direct inhibition of tyrosinase.

What is the CAS number for 4-Butylresorcinol?

The CAS number of 4-Butylresorcinol is 18979-61-8.

What is 4-Butylresorcinol (18979-61-8) used for?

4-n-butylresorcinol is a derivative of resorcinol and a potent human tyrosinase inhibitor. It may be used to decrease skin irritation and is also known to inhibit melanin production.InChI:InChI=1/C10H14O2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h5-7,11-12H,2-4H2,1H3