What is the N-Acetyl-DL-aspartic acid?

N-Acetyl-DL-aspartic acid is WHITE TO OFF-WHITE POWDER, while it's Molecular Formula is C6H9NO5. WHITE TO OFF-WHITE POWDER Used in Pharmaceutical Industry: N-Acetyl-DL-aspartic acid is used as a cognitive enhancer for its potential to improve memory and learning abilities. Its presence in neural tissues and its impact on cognitive function make it a promising candidate for the development of treatments targeting various nervous system disorders. Used in Neurodegenerative Disease Treatment: N-Acetyl-DL-aspartic acid is used as a therapeutic agent for its potential applications in treating neurodegenerative diseases. Its antioxidant properties and role in brain function suggest it may help mitigate the effects of such conditions. Used in Brain Injury Recovery: N-Acetyl-DL-aspartic acid is used as a recovery aid in cases of brain injury, leveraging its role in neural health and cognitive function to support the healing process. Used in Hormone Regulation: N-Acetyl-DL-aspartic acid is used as a hormonal regulator due to its suggested role in managing hormone levels, which can have implications for overall health and well-being. Used in Reproductive Function: N-Acetyl-DL-aspartic acid is used in the context of reproductive health for its potential influence on reproductive function, which may be beneficial for fertility and related health issues.

What is the CAS number for N-Acetyl-DL-aspartic acid?

The CAS number of N-Acetyl-DL-aspartic acid is 2545-40-6.

What is N-Acetyl-DL-aspartic acid (2545-40-6) used for?

N-Acetyl-DL-aspartic acid is a derivative of aspartic acid, an amino acid that plays a vital role in protein synthesis and the maintenance of nerve and brain function. It is formed by the combination of aspartic acid and acetic acid, and is predominantly found in the brain and other neural tissues. N-Acetyl-DL-aspartic acid has garnered interest due to its potential role in enhancing cognitive function, improving memory and learning abilities, and exhibiting antioxidant properties. Its therapeutic potential extends to neurodegenerative diseases, brain injuries, hormone regulation, and reproductive function, making it a significant component in neurological and cognitive health.InChI:InChI=1/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)

What is the N-Acetyl-DL-aspartic acid?

N-Acetyl-DL-aspartic acid is WHITE TO OFF-WHITE POWDER, while it's Molecular Formula is C6H9NO5. WHITE TO OFF-WHITE POWDER Used in Pharmaceutical Industry: N-Acetyl-DL-aspartic acid is used as a cognitive enhancer for its potential to improve memory and learning abilities. Its presence in neural tissues and its impact on cognitive function make it a promising candidate for the development of treatments targeting various nervous system disorders. Used in Neurodegenerative Disease Treatment: N-Acetyl-DL-aspartic acid is used as a therapeutic agent for its potential applications in treating neurodegenerative diseases. Its antioxidant properties and role in brain function suggest it may help mitigate the effects of such conditions. Used in Brain Injury Recovery: N-Acetyl-DL-aspartic acid is used as a recovery aid in cases of brain injury, leveraging its role in neural health and cognitive function to support the healing process. Used in Hormone Regulation: N-Acetyl-DL-aspartic acid is used as a hormonal regulator due to its suggested role in managing hormone levels, which can have implications for overall health and well-being. Used in Reproductive Function: N-Acetyl-DL-aspartic acid is used in the context of reproductive health for its potential influence on reproductive function, which may be beneficial for fertility and related health issues.

What is the CAS number for N-Acetyl-DL-aspartic acid?

The CAS number of N-Acetyl-DL-aspartic acid is 2545-40-6.

What is N-Acetyl-DL-aspartic acid (2545-40-6) used for?

N-Acetyl-DL-aspartic acid is a derivative of aspartic acid, an amino acid that plays a vital role in protein synthesis and the maintenance of nerve and brain function. It is formed by the combination of aspartic acid and acetic acid, and is predominantly found in the brain and other neural tissues. N-Acetyl-DL-aspartic acid has garnered interest due to its potential role in enhancing cognitive function, improving memory and learning abilities, and exhibiting antioxidant properties. Its therapeutic potential extends to neurodegenerative diseases, brain injuries, hormone regulation, and reproductive function, making it a significant component in neurological and cognitive health.InChI:InChI=1/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)

2545-40-6

N-Acetyl-DL-aspartic acid

别名：

CasNo.： 2545-40-6

分子式： C₆H₉NO₅

分子量： 175.141

储存条件：

在线咨询

中文名称： N-Acetyl-DL-aspartic acid

英文名称： N-Acetyl-DL-aspartic acid

CasNo.： 2545-40-6

分子式： C₆H₉NO₅

分子量： 175.141

Factory Supply Industrial Grade N-Acetyl-DL-aspartic acid 2545-40-6 with Best Price

Molecular Formula:C6H9NO5
Molecular Weight:175.141
Appearance/Colour:WHITE TO OFF-WHITE POWDER
Vapor Pressure:2E-08mmHg at 25°C
Refractive Index:1.505
Boiling Point:425.3 °C at 760 mmHg
PKA:3.14±0.10(Predicted)
Flash Point:211 °C
PSA：103.70000
Density:1.422 g/cm³
LogP:-0.55870

N-Acetyl-DL-aspartic acid(Cas 2545-40-6) Usage

General Description

N-Acetyl-DL-aspartic acid is a derivative of aspartic acid, an amino acid involved in the synthesis of proteins and the maintenance of nerve and brain function. N-Acetyl-DL-aspartic acid is a combination of aspartic acid and acetic acid, and it is commonly found in the brain and other neural tissues. N-Acetyl-DL-aspartic acid has been studied for its potential role in enhancing cognitive function and improving memory and learning abilities. It also has antioxidant properties and has been investigated for its potential therapeutic applications in neurodegenerative diseases and brain injuries. Additionally, it has been suggested to have a role in regulating hormone levels and reproductive function. Overall, N-Acetyl-DL-aspartic acid plays a crucial role in neurological and cognitive health and may have potential applications in the treatment of various nervous system disorders.

InChI:InChI=1/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)