What is the N-Acetyl-L-aspartic acid anhydride?

N-Acetyl-L-aspartic acid anhydride is , while it's Molecular Formula is C6H7NO4. Used in Medical Applications: N-Acetyl-L-aspartic acid anhydride is used as a metabolic marker for [application reason] in mammalian brain metabolism, contributing to the maintenance of myelin and effective nerve signal transmission. Used in NMR Spectroscopy: N-Acetyl-L-aspartic acid anhydride is used as a concentration marker for [application reason] in NMR spectroscopy assessments, due to its high concentration in the human brain, which aids in the analysis and interpretation of brain-related conditions. Used in Pharmaceutical Research: Although its general uses outside of medical contexts are not well-known, N-Acetyl-L-aspartic acid anhydride's role in brain metabolism and its potential as a marker in NMR spectroscopy suggest that it may have applications in pharmaceutical research for the development of treatments targeting neurological disorders or conditions affecting brain function.

What is the CAS number for N-Acetyl-L-aspartic acid anhydride?

The CAS number of N-Acetyl-L-aspartic acid anhydride is 41148-79-2.

What is N-Acetyl-L-aspartic acid anhydride (41148-79-2) used for?

N-Acetyl-L-aspartic acid anhydride is a chemical species derived from N-acetyl-L-aspartic acid, a molecule that plays a crucial role in mammalian brain metabolism. It is involved in maintaining myelin, a fatty substance that ensures effective nerve signal transmission. Additionally, it is used as a concentration marker for NMR spectroscopy assessments due to its high concentration in the human brain. As an anhydride, it is a compound formed by the removal of a water molecule from another compound.InChI:InChI=1/C6H7NO4/c1-3(8)7-4-2-5(9)11-6(4)10/h4H,2H2,1H3,(H,7,8)/t4-/m0/s1

What is the N-Acetyl-L-aspartic acid anhydride?

N-Acetyl-L-aspartic acid anhydride is , while it's Molecular Formula is C6H7NO4. Used in Medical Applications: N-Acetyl-L-aspartic acid anhydride is used as a metabolic marker for [application reason] in mammalian brain metabolism, contributing to the maintenance of myelin and effective nerve signal transmission. Used in NMR Spectroscopy: N-Acetyl-L-aspartic acid anhydride is used as a concentration marker for [application reason] in NMR spectroscopy assessments, due to its high concentration in the human brain, which aids in the analysis and interpretation of brain-related conditions. Used in Pharmaceutical Research: Although its general uses outside of medical contexts are not well-known, N-Acetyl-L-aspartic acid anhydride's role in brain metabolism and its potential as a marker in NMR spectroscopy suggest that it may have applications in pharmaceutical research for the development of treatments targeting neurological disorders or conditions affecting brain function.

What is the CAS number for N-Acetyl-L-aspartic acid anhydride?

The CAS number of N-Acetyl-L-aspartic acid anhydride is 41148-79-2.

What is N-Acetyl-L-aspartic acid anhydride (41148-79-2) used for?

N-Acetyl-L-aspartic acid anhydride is a chemical species derived from N-acetyl-L-aspartic acid, a molecule that plays a crucial role in mammalian brain metabolism. It is involved in maintaining myelin, a fatty substance that ensures effective nerve signal transmission. Additionally, it is used as a concentration marker for NMR spectroscopy assessments due to its high concentration in the human brain. As an anhydride, it is a compound formed by the removal of a water molecule from another compound.InChI:InChI=1/C6H7NO4/c1-3(8)7-4-2-5(9)11-6(4)10/h4H,2H2,1H3,(H,7,8)/t4-/m0/s1

41148-79-2

N-acetyl-L-aspartic acid-anhydride

Another Name：

CasNo.： 41148-79-2

MF： C₆H₇NO₄

MW： 157.126

Storage：

Online consultation

ch_Name： N-acetyl-L-aspartic acid-anhydride

English name： N-acetyl-L-aspartic acid-anhydride

CasNo.： 41148-79-2

MF： C₆H₇NO₄

MW： 157.126

Factory sells N-acetyl-L-aspartic acid-anhydride 41148-79-2 with sufficient production capacity

Molecular Formula:C6H7NO4
Molecular Weight:157.126
Vapor Pressure:0mmHg at 25°C
Melting Point:141 °C
Refractive Index:1.492
Boiling Point:479.3 °C at 760 mmHg
PKA:13.71±0.20(Predicted)
Flash Point:243.7 °C
PSA：72.47000
Density:1.36 g/cm³
LogP:-0.64450

N-Acetyl-L-aspartic acid anhydride(Cas 41148-79-2) Usage

General Description

N-Acetyl-L-aspartic acid anhydride is a chemical species that originates from N-acetyl-L-aspartic acid. This particular derivative is known for its significant role in mammalian brain metabolism, where it acts as a molecule involved in maintaining myelin - a fatty substance that ensures effective nerve signal transmission. It's also used as a concentration marker for NMR spectroscopy assessments due to its high concentration in human brain. Outside of medical contexts, little is known about its general uses or properties, although it's known to be an anhydride, meaning it's a compound derived from another by the removal of a water molecule.

InChI:InChI=1/C6H7NO4/c1-3(8)7-4-2-5(9)11-6(4)10/h4H,2H2,1H3,(H,7,8)/t4-/m0/s1