What is the 2-Vinylnaphthalene?

2-Vinylnaphthalene is Tan powder, while it's Molecular Formula is C12H10 . Tan powder Used in Plastics and Resins Production: 2-Vinylnaphthalene is used as a precursor in the synthesis of various polymers, contributing to the development of plastics and resins. Its unique structure allows for the creation of materials with specific properties tailored for different applications. Used in Pharmaceutical Manufacturing: In the pharmaceutical industry, 2-Vinylnaphthalene serves as an intermediate in the production of various medications. Its chemical properties make it a valuable component in the synthesis of complex drug molecules. Used in Fragrance Industry: 2-Vinylnaphthalene is utilized as a monomer for the production of vinyl naphthalene resins, which are essential in the formulation of fragrances. Its distinct floral scent makes it a desirable ingredient in creating a wide range of scents for perfumes and other aromatic products. However, it is important to note that 2-Vinylnaphthalene is a potential irritant. It can cause skin and eye irritation upon contact and may have harmful effects if inhaled, necessitating proper handling and safety measures during its use in various applications.

What is the CAS number for 2-Vinylnaphthalene?

The CAS number of 2-Vinylnaphthalene is 827-54-3.

What is 2-Vinylnaphthalene (827-54-3) used for?

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a colorless liquid characterized by a sweet, floral odor. As a vinylated naphthalene, it features a vinyl group attached to the naphthalene ring, which makes it a versatile building block in the chemical industry.InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2

What is the 2-Vinylnaphthalene?

2-Vinylnaphthalene is Tan powder, while it's Molecular Formula is C12H10 . Tan powder Used in Plastics and Resins Production: 2-Vinylnaphthalene is used as a precursor in the synthesis of various polymers, contributing to the development of plastics and resins. Its unique structure allows for the creation of materials with specific properties tailored for different applications. Used in Pharmaceutical Manufacturing: In the pharmaceutical industry, 2-Vinylnaphthalene serves as an intermediate in the production of various medications. Its chemical properties make it a valuable component in the synthesis of complex drug molecules. Used in Fragrance Industry: 2-Vinylnaphthalene is utilized as a monomer for the production of vinyl naphthalene resins, which are essential in the formulation of fragrances. Its distinct floral scent makes it a desirable ingredient in creating a wide range of scents for perfumes and other aromatic products. However, it is important to note that 2-Vinylnaphthalene is a potential irritant. It can cause skin and eye irritation upon contact and may have harmful effects if inhaled, necessitating proper handling and safety measures during its use in various applications.

What is the CAS number for 2-Vinylnaphthalene?

The CAS number of 2-Vinylnaphthalene is 827-54-3.

What is 2-Vinylnaphthalene (827-54-3) used for?

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a colorless liquid characterized by a sweet, floral odor. As a vinylated naphthalene, it features a vinyl group attached to the naphthalene ring, which makes it a versatile building block in the chemical industry.InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2

827-54-3

2-Vinylnaphthalene

Another Name：

CasNo.： 827-54-3

MF： C₁₂H₁₀

MW： 154.211

Storage：

Online consultation

ch_Name： 2-Vinylnaphthalene

English name： 2-Vinylnaphthalene

CasNo.： 827-54-3

MF： C₁₂H₁₀

MW： 154.211

Factory sells 2-Vinylnaphthalene 827-54-3 with sufficient production capacity

Molecular Formula:C12H10
Molecular Weight:154.211
Appearance/Colour:Tan powder
Melting Point:64-68 °C(lit.)
Boiling Point:270.9 °C at 760 mmHg
Flash Point:115.5 °C
PSA：0.00000
Density:1.031 g/cm³
LogP:3.48280

2-Vinylnaphthalene(Cas 827-54-3) Usage

General Description

2-Vinylnaphthalene, also known as 2-vinyl-1-naphthalene, is a chemical compound with the formula C12H10. It is a colorless liquid with a sweet, floral odor and is used in the production of plastics and resins. 2-Vinylnaphthalene is a vinylated naphthalene, meaning it has a vinyl group attached to the naphthalene ring. It is used as a precursor in the synthesis of various polymers and as a monomer for the production of vinyl naphthalene resins. It is also used as an intermediate in the manufacturing of pharmaceuticals and fragrances. However, 2-Vinylnaphthalene is also a potential irritant and can cause skin and eye irritation upon contact, as well as harmful effects if inhaled.

InChI:InChI=1/C12H10/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2-9H,1H2